1374829-47-6


 

4-CHLORO-N-ETHYL-5-(TRIFLUOROMETHYL)PYRIMIDIN-2-AMINE
CAS 1374829-47-6
ID 17001911

Molecular Formula   C7H7ClF3N3
Molecular Weight     225.60
Smile Code               ClC1=NC(=NC=C1C(F)(F)F)NCC

Quantity | Price        5g | USD2750
Availability               Typically in stock