1447958-78-2


 

METHYL 5-BROMO-2-(BROMOMETHYL)-6-CHLORONICOTINATE
CAS 1447958-78-2
ID 17001900

Molecular Formula   C8H6Br2ClNO2
Molecular Weight     343.40
Smile Code               BrC=1C(=NC(=C(C(=O)OC)C1)CBr)Cl

Quantity | Price        10g | USD2760
Availability               Typically in stock