180637-89-2


 

(R)-3-((1-METHYLPYRROLIDIN-2-YL)METHYL)-5-(2-(PHENYLSULFONYL)VINYL)-1H-INDOLE
CAS 180637-89-2
ID 17001961

Molecular Formula   C22H24N2O2S
Molecular Weight     380.51
Smile Code               CN1[C@H](CCC1)CC1=CNC2=CC=C(C=C12)C=CS(=O)(=O)C2=CC=CC=C2

Quantity | Price        1g | USD2750
Availability               Typically in stock