201046-36-8


 

(S)-2-((TERT-BUTOXYCARBONYL)AMINO)-5-(PYRAZINE-2-CARBOXAMIDO)PENTANOIC ACID
CAS 201046-36-8
ID 17001950

Molecular Formula   C15H22N4O5
Molecular Weight     338.36
Smile Code               C(C)(C)(C)OC(=O)N[C@H](C(=O)O)CCCNC(=O)C1=NC=CN=C1

Quantity | Price        25g | USD2750
Availability               Typically in stock