603965-77-1


 

ETHYL 2-(PIPERAZIN-1-YL)PYRIMIDINE-5-CARBOXYLATE
CAS 603965-77-1
ID 17001967

Molecular Formula   C11H16N4O2
Molecular Weight     236.27
Smile Code               N1(CCNCC1)C1=NC=C(C=N1)C(=O)OCC

Quantity | Price        1g | USD2750
Availability               Typically in stock