869478-09-1


 

8-ACETYL-6-(BENZYLOXY)-2H-BENZO[B][1,4]OXAZIN-3(4H)-ONE
CAS 869478-09-1
ID 17001939

Molecular Formula   C17H15NO4
Molecular Weight     297.31
Smile Code               C(C)(=O)C1=CC(=CC2=C1OCC(N2)=O)OCC2=CC=CC=C2

Quantity | Price        25g | USD2750
Availability               Typically in stock